C15H16N3O2- — CID 139049808
4,4-dimethyl-3-oxido-2,2-dipyridin-2-yl-1,3-oxazolidine (PubChem CID 139049808) has the molecular formula C15H16N3O2- and a molecular weight of 270.31 g/mol. Its IUPAC name is 4,4-dimethyl-3-oxido-2,2-dipyridin-2-yl-1,3-oxazolidine.
| Compound Name | 4,4-dimethyl-3-oxido-2,2-dipyridin-2-yl-1,3-oxazolidine |
|---|---|
| PubChem CID | 139049808 |
| Molecular Formula | C15H16N3O2- |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4,4-dimethyl-3-oxido-2,2-dipyridin-2-yl-1,3-oxazolidine |
| SMILES | CC1(C)COC(c2ccccn2)(c2ccccn2)N1[O-] |
| InChI | InChI=1S/C15H16N3O2/c1-14(2)11-20-15(18(14)19,12-7-3-5-9-16-12)13-8-4-6-10-17-13/h3-10H,11H2,1-2H3/q-1 |
| InChIKey | VRAWAVGPKRHFAE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |