C56H56N4O4S2 — CID 139049979
N-[(5S)-5-(1H-indol-3-yl)-2-(4-methylphenyl)cyclopenten-1-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 139049979) has the molecular formula C56H56N4O4S2 and a molecular weight of 913.22 g/mol. Its IUPAC name is N-[(5S)-5-(1H-indol-3-yl)-2-(4-methylphenyl)cyclopenten-1-yl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(5S)-5-(1H-indol-3-yl)-2-(4-methylphenyl)cyclopenten-1-yl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 139049979 |
| Molecular Formula | C56H56N4O4S2 |
| Molecular Weight | 913.22 g/mol |
| Exact Mass | 912.37 |
| IUPAC Name | N-[(5S)-5-(1H-indol-3-yl)-2-(4-methylphenyl)cyclopenten-1-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C2=C(N(C)S(=O)(=O)c3ccc(C)cc3)[C@H](c3c[nH]c4ccccc34)CC2)cc1.Cc1ccc(C2=C(N(C)S(=O)(=O)c3ccc(C)cc3)[C@H](c3c[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/2C28H28N2O2S/c2*1-19-8-12-21(13-9-19)23-16-17-25(26-18-29-27-7-5-4-6-24(26)27)28(23)30(3)33(31,32)22-14-10-20(2)11-15-22/h2*4-15,18,25,29H,16-17H2,1-3H3/t2*25-/m00/s1 |
| InChIKey | WIKKYLFZXVMBGK-TVYLAEMUSA-N |
| XLogP | 12.79 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.22 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |