C16H24O7 — CID 139050150
ethyl (2R,3S,4S)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate (PubChem CID 139050150) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is ethyl (2R,3S,4S)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl (2R,3S,4S)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 139050150 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | ethyl (2R,3S,4S)-2,8,8-trimethyl-6,10-dioxo-4-propan-2-yl-1,7,9-trioxaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C)OC2(C(=O)OC(C)(C)OC2=O)[C@H]1C(C)C |
| InChI | InChI=1S/C16H24O7/c1-7-20-12(17)10-9(4)21-16(11(10)8(2)3)13(18)22-15(5,6)23-14(16)19/h8-11H,7H2,1-6H3/t9-,10-,11+/m1/s1 |
| InChIKey | BXYDQXPRVIIWOR-MXWKQRLJSA-N |
| XLogP | 1.43 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|