About tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide
tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide (PubChem CID 139050302) has the molecular formula C8BF4N4-
and a molecular weight of 238.92 g/mol. Its IUPAC name is tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide.
Molecular Properties
| Compound Name | tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide |
| PubChem CID | 139050302 |
| Molecular Formula | C8BF4N4- |
| Molecular Weight | 238.92 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide |
| SMILES | N#C[B-](C#N)(C#N)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C8BF4N4/c10-5-4(9(1-14,2-15)3-16)6(11)8(13)17-7(5)12/q-1 |
| InChIKey | UHLPNRZXFIDFKI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.92 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide?
The IUPAC name of tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide (CID 139050302) is tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide.
What is the SMILES notation for tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide?
The canonical SMILES for tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide is N#C[B-](C#N)(C#N)c1c(F)c(F)nc(F)c1F.
What is the InChIKey of tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide?
The InChIKey is UHLPNRZXFIDFKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8BF4N4/c10-5-4(9(1-14,2-15)3-16)6(11)8(13)17-7(5)12/q-1.
What are the key properties of tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide?
tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide has a molecular weight of 238.92 g/mol, XLogP of 0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tricyano-(2,3,5,6-tetrafluoro-4-pyridinyl)boranuide is sourced from PubChem (CID 139050302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).