About difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate
difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate (PubChem CID 139050395) has the molecular formula C17H19BF6S
and a molecular weight of 380.21 g/mol. Its IUPAC name is difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate.
Molecular Properties
| Compound Name | difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate |
| PubChem CID | 139050395 |
| Molecular Formula | C17H19BF6S |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate |
| SMILES | Cc1ccc(C)c([S+](c2cc(C)ccc2C)C(F)F)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C17H19F2S.BF4/c1-11-5-7-13(3)15(9-11)20(17(18)19)16-10-12(2)6-8-14(16)4;2-1(3,4)5/h5-10,17H,1-4H3;/q+1;-1 |
| InChIKey | PZFHGJCOZXVMNR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate?
The IUPAC name of difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate (CID 139050395) is difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate.
What is the SMILES notation for difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate?
The canonical SMILES for difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate is Cc1ccc(C)c([S+](c2cc(C)ccc2C)C(F)F)c1.F[B-](F)(F)F.
What is the InChIKey of difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate?
The InChIKey is PZFHGJCOZXVMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2S.BF4/c1-11-5-7-13(3)15(9-11)20(17(18)19)16-10-12(2)6-8-14(16)4;2-1(3,4)5/h5-10,17H,1-4H3;/q+1;-1.
What are the key properties of difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate?
difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate has a molecular weight of 380.21 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethyl-bis(2,5-dimethylphenyl)sulfanium tetrafluoroborate is sourced from PubChem (CID 139050395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).