C29H45NO5 — CID 139050477
[(1R,2S,4S,5'R,6R,7S,8R,9S,10E,12S,13S,16S,18S)-10-hydroxyimino-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] acetate (PubChem CID 139050477) has the molecular formula C29H45NO5 and a molecular weight of 487.68 g/mol. Its IUPAC name is [(1R,2S,4S,5'R,6R,7S,8R,9S,10E,12S,13S,16S,18S)-10-hydroxyimino-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] acetate.
| Compound Name | [(1R,2S,4S,5'R,6R,7S,8R,9S,10E,12S,13S,16S,18S)-10-hydroxyimino-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] acetate |
|---|---|
| PubChem CID | 139050477 |
| Molecular Formula | C29H45NO5 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | [(1R,2S,4S,5'R,6R,7S,8R,9S,10E,12S,13S,16S,18S)-10-hydroxyimino-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2C/C(=N\O)[C@]2(C)[C@@H]4[C@H](C[C@@H]32)O[C@]2(CC[C@@H](C)CO2)[C@H]4C)C1 |
| InChI | InChI=1S/C29H45NO5/c1-16-8-11-29(33-15-16)17(2)26-24(35-29)13-23-21-7-6-19-12-20(34-18(3)31)9-10-27(19,4)22(21)14-25(30-32)28(23,26)5/h16-17,19-24,26,32H,6-15H2,1-5H3/b30-25+/t16-,17+,19+,20+,21-,22+,23+,24+,26+,27+,28-,29-/m1/s1 |
| InChIKey | XUWDLCJMVNFEDO-JQIWJZSMSA-N |
| XLogP | 5.80 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|