C42H44N4O14 — CID 139050786
[(2S,3S)-3-methyl-2-phenylmethoxyhex-5-en-3-yl] 3,5-dinitrobenzoate (PubChem CID 139050786) has the molecular formula C42H44N4O14 and a molecular weight of 828.83 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-2-phenylmethoxyhex-5-en-3-yl] 3,5-dinitrobenzoate.
| Compound Name | [(2S,3S)-3-methyl-2-phenylmethoxyhex-5-en-3-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139050786 |
| Molecular Formula | C42H44N4O14 |
| Molecular Weight | 828.83 g/mol |
| Exact Mass | 828.29 |
| IUPAC Name | [(2S,3S)-3-methyl-2-phenylmethoxyhex-5-en-3-yl] 3,5-dinitrobenzoate |
| SMILES | C=CC[C@](C)(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@H](C)OCc1ccccc1.C=CC[C@](C)(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/2C21H22N2O7/c2*1-4-10-21(3,15(2)29-14-16-8-6-5-7-9-16)30-20(24)17-11-18(22(25)26)13-19(12-17)23(27)28/h2*4-9,11-13,15H,1,10,14H2,2-3H3/t2*15-,21-/m00/s1 |
| InChIKey | GMSIWGYTHOUPFU-RRISAKKPSA-N |
| XLogP | 9.20 |
| TPSA | 243.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.83 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|