C17H13BrN2O2 — CID 139050847
(2S,3S)-2-(3-bromophenyl)-7-methyl-5-phenyl-1-oxa-5,6-diazaspiro[2.4]hept-6-en-4-one (PubChem CID 139050847) has the molecular formula C17H13BrN2O2 and a molecular weight of 357.21 g/mol. Its IUPAC name is (2S,3S)-2-(3-bromophenyl)-7-methyl-5-phenyl-1-oxa-5,6-diazaspiro[2.4]hept-6-en-4-one.
| Compound Name | (2S,3S)-2-(3-bromophenyl)-7-methyl-5-phenyl-1-oxa-5,6-diazaspiro[2.4]hept-6-en-4-one |
|---|---|
| PubChem CID | 139050847 |
| Molecular Formula | C17H13BrN2O2 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (2S,3S)-2-(3-bromophenyl)-7-methyl-5-phenyl-1-oxa-5,6-diazaspiro[2.4]hept-6-en-4-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@]12O[C@H]2c1cccc(Br)c1 |
| InChI | InChI=1S/C17H13BrN2O2/c1-11-17(15(22-17)12-6-5-7-13(18)10-12)16(21)20(19-11)14-8-3-2-4-9-14/h2-10,15H,1H3/t15-,17-/m0/s1 |
| InChIKey | FTDOSEKEYZLZJU-RDJZCZTQSA-N |
| XLogP | 3.68 |
| TPSA | 45.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|