C14H16O4 — CID 139050857
(1S,5S,7S)-9,9-dimethoxy-2-methyltricyclo[5.2.2.01,5]undeca-2,10-diene-4,8-dione (PubChem CID 139050857) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (1S,5S,7S)-9,9-dimethoxy-2-methyltricyclo[5.2.2.01,5]undeca-2,10-diene-4,8-dione.
| Compound Name | (1S,5S,7S)-9,9-dimethoxy-2-methyltricyclo[5.2.2.01,5]undeca-2,10-diene-4,8-dione |
|---|---|
| PubChem CID | 139050857 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1S,5S,7S)-9,9-dimethoxy-2-methyltricyclo[5.2.2.01,5]undeca-2,10-diene-4,8-dione |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C[C@]13C(C)=CC(=O)[C@H]3C2 |
| InChI | InChI=1S/C14H16O4/c1-8-6-11(15)10-7-9-4-5-13(8,10)14(17-2,18-3)12(9)16/h4-6,9-10H,7H2,1-3H3/t9-,10-,13-/m1/s1 |
| InChIKey | JKGRGJHXKSKROR-GIPNMCIBSA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|