About (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one
(3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one (PubChem CID 139051089) has the molecular formula C26H23NO
and a molecular weight of 365.48 g/mol. Its IUPAC name is (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one.
Molecular Properties
| Compound Name | (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one |
| PubChem CID | 139051089 |
| Molecular Formula | C26H23NO |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one |
| SMILES | CN1C(=O)[C@@](C/C=C/C=C/c2ccccc2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H23NO/c1-27-24-19-11-10-18-23(24)26(25(27)28,22-16-8-3-9-17-22)20-12-4-7-15-21-13-5-2-6-14-21/h2-19H,20H2,1H3/b12-4+,15-7+/t26-/m0/s1 |
| InChIKey | RBKRTQPMLKMVJH-OOVOLLPLSA-N |
| XLogP | 5.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one?
The IUPAC name of (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one (CID 139051089) is (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one.
What is the SMILES notation for (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one?
The canonical SMILES for (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one is CN1C(=O)[C@@](C/C=C/C=C/c2ccccc2)(c2ccccc2)c2ccccc21.
What is the InChIKey of (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one?
The InChIKey is RBKRTQPMLKMVJH-OOVOLLPLSA-N. The full InChI is InChI=1S/C26H23NO/c1-27-24-19-11-10-18-23(24)26(25(27)28,22-16-8-3-9-17-22)20-12-4-7-15-21-13-5-2-6-14-21/h2-19H,20H2,1H3/b12-4+,15-7+/t26-/m0/s1.
What are the key properties of (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one?
(3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one has a molecular weight of 365.48 g/mol, XLogP of 5.61, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-methyl-3-phenyl-3-[(2E,4E)-5-phenylpenta-2,4-dienyl]indol-2-one is sourced from PubChem (CID 139051089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).