C30H28O6S2 — CID 139051098
(4S)-4-(4-methylphenyl)-3,4-dihydro-1,2λ6-benzoxathiine 2,2-dioxide (PubChem CID 139051098) has the molecular formula C30H28O6S2 and a molecular weight of 548.68 g/mol. Its IUPAC name is (4S)-4-(4-methylphenyl)-3,4-dihydro-1,2λ6-benzoxathiine 2,2-dioxide.
| Compound Name | (4S)-4-(4-methylphenyl)-3,4-dihydro-1,2λ6-benzoxathiine 2,2-dioxide |
|---|---|
| PubChem CID | 139051098 |
| Molecular Formula | C30H28O6S2 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | (4S)-4-(4-methylphenyl)-3,4-dihydro-1,2λ6-benzoxathiine 2,2-dioxide |
| SMILES | Cc1ccc([C@@H]2CS(=O)(=O)Oc3ccccc32)cc1.Cc1ccc([C@@H]2CS(=O)(=O)Oc3ccccc32)cc1 |
| InChI | InChI=1S/2C15H14O3S/c2*1-11-6-8-12(9-7-11)14-10-19(16,17)18-15-5-3-2-4-13(14)15/h2*2-9,14H,10H2,1H3/t2*14-/m00/s1 |
| InChIKey | BKSJCPGILDTTFG-DXZWIFNPSA-N |
| XLogP | 5.70 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|