C16H26O7 — CID 139051287
methyl 2-[(1R,3S,7R,8R,10S)-1-(hydroxymethyl)-5,5-dimethyl-4,6,9,14-tetraoxatricyclo[8.4.0.03,7]tetradecan-8-yl]acetate (PubChem CID 139051287) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl 2-[(1R,3S,7R,8R,10S)-1-(hydroxymethyl)-5,5-dimethyl-4,6,9,14-tetraoxatricyclo[8.4.0.03,7]tetradecan-8-yl]acetate.
| Compound Name | methyl 2-[(1R,3S,7R,8R,10S)-1-(hydroxymethyl)-5,5-dimethyl-4,6,9,14-tetraoxatricyclo[8.4.0.03,7]tetradecan-8-yl]acetate |
|---|---|
| PubChem CID | 139051287 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | methyl 2-[(1R,3S,7R,8R,10S)-1-(hydroxymethyl)-5,5-dimethyl-4,6,9,14-tetraoxatricyclo[8.4.0.03,7]tetradecan-8-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@H]2CCCO[C@@]2(CO)C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C16H26O7/c1-15(2)22-11-8-16(9-17)12(5-4-6-20-16)21-10(14(11)23-15)7-13(18)19-3/h10-12,14,17H,4-9H2,1-3H3/t10-,11+,12+,14-,16-/m1/s1 |
| InChIKey | HVRFRTCPMRZVBW-HBYDAFANSA-N |
| XLogP | 0.77 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |