C15H24O2 — CID 139051302
(1R,3E,7Z,11S)-1,5,5-trimethyl-12-oxabicyclo[6.3.2]trideca-3,7-dien-11-ol (PubChem CID 139051302) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,3E,7Z,11S)-1,5,5-trimethyl-12-oxabicyclo[6.3.2]trideca-3,7-dien-11-ol.
| Compound Name | (1R,3E,7Z,11S)-1,5,5-trimethyl-12-oxabicyclo[6.3.2]trideca-3,7-dien-11-ol |
|---|---|
| PubChem CID | 139051302 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,3E,7Z,11S)-1,5,5-trimethyl-12-oxabicyclo[6.3.2]trideca-3,7-dien-11-ol |
| SMILES | CC1(C)/C=C\C[C@@]2(C)OC/C(=C\C1)CC[C@@H]2O |
| InChI | InChI=1S/C15H24O2/c1-14(2)8-4-9-15(3)13(16)6-5-12(7-10-14)11-17-15/h4,7-8,13,16H,5-6,9-11H2,1-3H3/b8-4-,12-7-/t13-,15+/m0/s1 |
| InChIKey | AJHJYINTDZGJGY-VGDKCGCVSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|