C37H38NO4P — CID 139051369
bis(2,6-dimethylphenyl) [(1S,2S)-1,2-diphenyl-1-pyridin-4-ylbutyl] phosphate (PubChem CID 139051369) has the molecular formula C37H38NO4P and a molecular weight of 591.69 g/mol. Its IUPAC name is bis(2,6-dimethylphenyl) [(1S,2S)-1,2-diphenyl-1-pyridin-4-ylbutyl] phosphate.
| Compound Name | bis(2,6-dimethylphenyl) [(1S,2S)-1,2-diphenyl-1-pyridin-4-ylbutyl] phosphate |
|---|---|
| PubChem CID | 139051369 |
| Molecular Formula | C37H38NO4P |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | bis(2,6-dimethylphenyl) [(1S,2S)-1,2-diphenyl-1-pyridin-4-ylbutyl] phosphate |
| SMILES | CC[C@@H](c1ccccc1)[C@](OP(=O)(Oc1c(C)cccc1C)Oc1c(C)cccc1C)(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C37H38NO4P/c1-6-34(31-19-9-7-10-20-31)37(32-21-11-8-12-22-32,33-23-25-38-26-24-33)42-43(39,40-35-27(2)15-13-16-28(35)3)41-36-29(4)17-14-18-30(36)5/h7-26,34H,6H2,1-5H3/t34-,37-/m0/s1 |
| InChIKey | JLEBBWCRDQDURB-UNVMMQEESA-N |
| XLogP | 10.04 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|