C26H28O6 — CID 139051455
2,5-dihydroxy-3-methoxy-6-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-ene-1-carbonyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 139051455) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is 2,5-dihydroxy-3-methoxy-6-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-ene-1-carbonyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3-methoxy-6-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-ene-1-carbonyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 139051455 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2,5-dihydroxy-3-methoxy-6-[(1R,6R)-4-(4-methylpent-3-enyl)-6-phenylcyclohex-3-ene-1-carbonyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(O)C(=O)C(C(=O)[C@@H]2CC=C(CCC=C(C)C)C[C@H]2c2ccccc2)=C(O)C1=O |
| InChI | InChI=1S/C26H28O6/c1-15(2)8-7-9-16-12-13-18(19(14-16)17-10-5-4-6-11-17)21(27)20-22(28)24(30)26(32-3)25(31)23(20)29/h4-6,8,10-12,18-19,28,31H,7,9,13-14H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | UYVCBFPMXCEFNU-MOPGFXCFSA-N |
| XLogP | 4.80 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|