C29H39B2NO2 — CID 139051574
pyridin-1-ium-1-yl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-bis(2,4,6-trimethylphenyl)boranuide (PubChem CID 139051574) has the molecular formula C29H39B2NO2 and a molecular weight of 455.26 g/mol. Its IUPAC name is pyridin-1-ium-1-yl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-bis(2,4,6-trimethylphenyl)boranuide.
| Compound Name | pyridin-1-ium-1-yl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-bis(2,4,6-trimethylphenyl)boranuide |
|---|---|
| PubChem CID | 139051574 |
| Molecular Formula | C29H39B2NO2 |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 455.32 |
| IUPAC Name | pyridin-1-ium-1-yl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-bis(2,4,6-trimethylphenyl)boranuide |
| SMILES | Cc1cc(C)c([B-](B2OC(C)(C)C(C)(C)O2)(c2c(C)cc(C)cc2C)[n+]2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H39B2NO2/c1-20-16-22(3)26(23(4)17-20)31(32-14-12-11-13-15-32,27-24(5)18-21(2)19-25(27)6)30-33-28(7,8)29(9,10)34-30/h11-19H,1-10H3 |
| InChIKey | MHVOCCRFQJGVSF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|