C18H34O7 — CID 139051785
(1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(E,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol;hydrate (PubChem CID 139051785) has the molecular formula C18H34O7 and a molecular weight of 362.46 g/mol. Its IUPAC name is (1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(E,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol;hydrate.
| Compound Name | (1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(E,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol;hydrate |
|---|---|
| PubChem CID | 139051785 |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(E,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol;hydrate |
| SMILES | CCCCCCCC[C@H](O)/C=C/C1=C(CO)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O.O |
| InChI | InChI=1S/C18H32O6.H2O/c1-2-3-4-5-6-7-8-12(20)9-10-13-14(11-19)16(22)18(24)17(23)15(13)21;/h9-10,12,15-24H,2-8,11H2,1H3;1H2/b10-9+;/t12-,15+,16+,17-,18-;/m0./s1 |
| InChIKey | SXIAJVWBGRYENJ-VRIWWGAISA-N |
| XLogP | -0.42 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|