C18H29CoF6N5O6S2 — CID 139051839
cobalt(2+);2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-N,N-dimethylpyridin-4-amine;bis(trifluoromethanesulfonate) (PubChem CID 139051839) has the molecular formula C18H29CoF6N5O6S2 and a molecular weight of 648.51 g/mol. Its IUPAC name is cobalt(2+);2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-N,N-dimethylpyridin-4-amine;bis(trifluoromethanesulfonate).
| Compound Name | cobalt(2+);2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-N,N-dimethylpyridin-4-amine;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139051839 |
| Molecular Formula | C18H29CoF6N5O6S2 |
| Molecular Weight | 648.51 g/mol |
| Exact Mass | 648.08 |
| IUPAC Name | cobalt(2+);2-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-N,N-dimethylpyridin-4-amine;bis(trifluoromethanesulfonate) |
| SMILES | CN1CCN(C)CCN(Cc2cc(N(C)C)ccn2)CC1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Co+2] |
| InChI | InChI=1S/C16H29N5.2CHF3O3S.Co/c1-18(2)16-5-6-17-15(13-16)14-21-11-9-19(3)7-8-20(4)10-12-21;2*2-1(3,4)8(5,6)7;/h5-6,13H,7-12,14H2,1-4H3;2*(H,5,6,7);/q;;;+2/p-2 |
| InChIKey | GMWNTCIAYJEUJD-UHFFFAOYSA-L |
| XLogP | 0.93 |
| TPSA | 140.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.51 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|