C7H10O3S2 — CID 139051898
(4aS,6S,7aS)-6-methoxy-4a,6,7,7a-tetrahydro-4H-furo[2,3-e][1,3]oxathiine-2-thione (PubChem CID 139051898) has the molecular formula C7H10O3S2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (4aS,6S,7aS)-6-methoxy-4a,6,7,7a-tetrahydro-4H-furo[2,3-e][1,3]oxathiine-2-thione.
| Compound Name | (4aS,6S,7aS)-6-methoxy-4a,6,7,7a-tetrahydro-4H-furo[2,3-e][1,3]oxathiine-2-thione |
|---|---|
| PubChem CID | 139051898 |
| Molecular Formula | C7H10O3S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | (4aS,6S,7aS)-6-methoxy-4a,6,7,7a-tetrahydro-4H-furo[2,3-e][1,3]oxathiine-2-thione |
| SMILES | CO[C@@H]1C[C@@H]2OC(=S)SC[C@H]2O1 |
| InChI | InChI=1S/C7H10O3S2/c1-8-6-2-4-5(9-6)3-12-7(11)10-4/h4-6H,2-3H2,1H3/t4-,5+,6-/m0/s1 |
| InChIKey | IYMOEFUVBISMCF-JKUQZMGJSA-N |
| XLogP | 1.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|