About [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide
[(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide (PubChem CID 139051927) has the molecular formula C31H35BN2O
and a molecular weight of 462.45 g/mol. Its IUPAC name is [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide.
Molecular Properties
| Compound Name | [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide |
| PubChem CID | 139051927 |
| Molecular Formula | C31H35BN2O |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide |
| SMILES | C[N+](C)(C)C[C@H](O)CC#N.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C7H15N2O/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-9(2,3)6-7(10)4-5-8/h1-20H;7,10H,4,6H2,1-3H3/q-1;+1/t;7-/m.1/s1 |
| InChIKey | DMHGTCBZVKJWTK-HMZWWLAASA-N |
| XLogP | 3.03 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide?
The IUPAC name of [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide (CID 139051927) is [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide.
What is the SMILES notation for [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide?
The canonical SMILES for [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide is C[N+](C)(C)C[C@H](O)CC#N.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide?
The InChIKey is DMHGTCBZVKJWTK-HMZWWLAASA-N. The full InChI is InChI=1S/C24H20B.C7H15N2O/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-9(2,3)6-7(10)4-5-8/h1-20H;7,10H,4,6H2,1-3H3/q-1;+1/t;7-/m.1/s1.
What are the key properties of [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide?
[(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide has a molecular weight of 462.45 g/mol, XLogP of 3.03, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium;tetraphenylboranuide is sourced from PubChem (CID 139051927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).