C72H52N4O4 — CID 139051954
4-[1-(4-hydroxyphenyl)-2,2-bis(4-pyridin-4-ylphenyl)ethenyl]phenol (PubChem CID 139051954) has the molecular formula C72H52N4O4 and a molecular weight of 1037.23 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)-2,2-bis(4-pyridin-4-ylphenyl)ethenyl]phenol.
| Compound Name | 4-[1-(4-hydroxyphenyl)-2,2-bis(4-pyridin-4-ylphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 139051954 |
| Molecular Formula | C72H52N4O4 |
| Molecular Weight | 1037.23 g/mol |
| Exact Mass | 1036.40 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)-2,2-bis(4-pyridin-4-ylphenyl)ethenyl]phenol |
| SMILES | Oc1ccc(C(=C(c2ccc(-c3ccncc3)cc2)c2ccc(-c3ccncc3)cc2)c2ccc(O)cc2)cc1.Oc1ccc(C(=C(c2ccc(-c3ccncc3)cc2)c2ccc(-c3ccncc3)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/2C36H26N2O2/c2*39-33-13-9-31(10-14-33)36(32-11-15-34(40)16-12-32)35(29-5-1-25(2-6-29)27-17-21-37-22-18-27)30-7-3-26(4-8-30)28-19-23-38-24-20-28/h2*1-24,39-40H |
| InChIKey | PKBOBFODAVUODD-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.23 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|