C36H24Cl4N2O8 — CID 139052080
4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-[(E)-2-(2,4-dichlorophenyl)ethenyl]pyridin-1-ium) (PubChem CID 139052080) has the molecular formula C36H24Cl4N2O8 and a molecular weight of 754.41 g/mol. Its IUPAC name is 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-[(E)-2-(2,4-dichlorophenyl)ethenyl]pyridin-1-ium).
| Compound Name | 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-[(E)-2-(2,4-dichlorophenyl)ethenyl]pyridin-1-ium) |
|---|---|
| PubChem CID | 139052080 |
| Molecular Formula | C36H24Cl4N2O8 |
| Molecular Weight | 754.41 g/mol |
| Exact Mass | 752.03 |
| IUPAC Name | 4,6-dicarboxybenzene-1,3-dicarboxylate;bis(4-[(E)-2-(2,4-dichlorophenyl)ethenyl]pyridin-1-ium) |
| SMILES | Clc1ccc(/C=C/c2cc[nH+]cc2)c(Cl)c1.Clc1ccc(/C=C/c2cc[nH+]cc2)c(Cl)c1.O=C([O-])c1cc(C(=O)[O-])c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/2C13H9Cl2N.C10H6O8/c2*14-12-4-3-11(13(15)9-12)2-1-10-5-7-16-8-6-10;11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h2*1-9H;1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/b2*2-1+; |
| InChIKey | YCWAKFDEFIMQDO-BUOKYLHBSA-N |
| XLogP | 5.77 |
| TPSA | 183.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |