C22H16Br2FI2N3 — CID 139052223
4-fluoro-2,6-bis[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]aniline dibromide (PubChem CID 139052223) has the molecular formula C22H16Br2FI2N3 and a molecular weight of 755.00 g/mol. Its IUPAC name is 4-fluoro-2,6-bis[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]aniline dibromide.
| Compound Name | 4-fluoro-2,6-bis[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]aniline dibromide |
|---|---|
| PubChem CID | 139052223 |
| Molecular Formula | C22H16Br2FI2N3 |
| Molecular Weight | 755.00 g/mol |
| Exact Mass | 752.78 |
| IUPAC Name | 4-fluoro-2,6-bis[2-(3-iodo-1-methylpyridin-1-ium-4-yl)ethynyl]aniline dibromide |
| SMILES | C[n+]1ccc(C#Cc2cc(F)cc(C#Cc3cc[n+](C)cc3I)c2N)c(I)c1.[Br-].[Br-] |
| InChI | InChI=1S/C22H15FI2N3.2BrH/c1-27-9-7-15(20(24)13-27)3-5-17-11-19(23)12-18(22(17)26)6-4-16-8-10-28(2)14-21(16)25;;/h7-14,26H,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | PYWFDPFNWDGSFY-UHFFFAOYSA-M |
| XLogP | -2.93 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.00 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|