C28H27IN4OS2 — CID 139052884
O-[2-(1,3-benzothiazol-2-yl)-6-[(E)-2-(1,3-dimethylbenzimidazol-3-ium-2-yl)ethenyl]-4-methylphenyl] N,N-dimethylcarbamothioate iodide (PubChem CID 139052884) has the molecular formula C28H27IN4OS2 and a molecular weight of 626.59 g/mol. Its IUPAC name is O-[2-(1,3-benzothiazol-2-yl)-6-[(E)-2-(1,3-dimethylbenzimidazol-3-ium-2-yl)ethenyl]-4-methylphenyl] N,N-dimethylcarbamothioate iodide.
| Compound Name | O-[2-(1,3-benzothiazol-2-yl)-6-[(E)-2-(1,3-dimethylbenzimidazol-3-ium-2-yl)ethenyl]-4-methylphenyl] N,N-dimethylcarbamothioate iodide |
|---|---|
| PubChem CID | 139052884 |
| Molecular Formula | C28H27IN4OS2 |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 626.07 |
| IUPAC Name | O-[2-(1,3-benzothiazol-2-yl)-6-[(E)-2-(1,3-dimethylbenzimidazol-3-ium-2-yl)ethenyl]-4-methylphenyl] N,N-dimethylcarbamothioate iodide |
| SMILES | Cc1cc(/C=C/c2n(C)c3ccccc3[n+]2C)c(OC(=S)N(C)C)c(-c2nc3ccccc3s2)c1.[I-] |
| InChI | InChI=1S/C28H27N4OS2.HI/c1-18-16-19(14-15-25-31(4)22-11-7-8-12-23(22)32(25)5)26(33-28(34)30(2)3)20(17-18)27-29-21-10-6-9-13-24(21)35-27;/h6-17H,1-5H3;1H/q+1;/p-1/b15-14+; |
| InChIKey | KOAVPOMUOPCKRM-WPDLWGESSA-M |
| XLogP | 2.99 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|