About [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate
[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 139052891) has the molecular formula C38H28N4O8S2
and a molecular weight of 732.80 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| PubChem CID | 139052891 |
| Molecular Formula | C38H28N4O8S2 |
| Molecular Weight | 732.80 g/mol |
| Exact Mass | 732.13 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1.CN(C)C(=O)Oc1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/2C19H14N2O4S/c2*1-21(2)19(23)24-12-8-7-11-9-13(18(22)25-15(11)10-12)17-20-14-5-3-4-6-16(14)26-17/h2*3-10H,1-2H3 |
| InChIKey | GJCHCUUJMAOWPY-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 145.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 732.80 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate?
The IUPAC name of [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate (CID 139052891) is [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate?
The canonical SMILES for [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate is CN(C)C(=O)Oc1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1.CN(C)C(=O)Oc1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1.
What is the InChIKey of [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate?
The InChIKey is GJCHCUUJMAOWPY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C19H14N2O4S/c2*1-21(2)19(23)24-12-8-7-11-9-13(18(22)25-15(11)10-12)17-20-14-5-3-4-6-16(14)26-17/h2*3-10H,1-2H3.
What are the key properties of [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate?
[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate has a molecular weight of 732.80 g/mol, XLogP of 8.26, 4 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 139052891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).