About 9-ethyl-3-nitrocarbazole
9-ethyl-3-nitrocarbazole (PubChem CID 139053303) has the molecular formula C28H24N4O4
and a molecular weight of 480.52 g/mol. Its IUPAC name is 9-ethyl-3-nitrocarbazole.
Molecular Properties
| Compound Name | 9-ethyl-3-nitrocarbazole |
| PubChem CID | 139053303 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 9-ethyl-3-nitrocarbazole |
| SMILES | CCn1c2ccccc2c2cc([N+](=O)[O-])ccc21.CCn1c2ccccc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/2C14H12N2O2/c2*1-2-15-13-6-4-3-5-11(13)12-9-10(16(17)18)7-8-14(12)15/h2*3-9H,2H2,1H3 |
| InChIKey | CBUNCFJCSLYKAI-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 96.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-3-nitrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-3-nitrocarbazole?
The IUPAC name of 9-ethyl-3-nitrocarbazole (CID 139053303) is 9-ethyl-3-nitrocarbazole.
What is the SMILES notation for 9-ethyl-3-nitrocarbazole?
The canonical SMILES for 9-ethyl-3-nitrocarbazole is CCn1c2ccccc2c2cc([N+](=O)[O-])ccc21.CCn1c2ccccc2c2cc([N+](=O)[O-])ccc21.
What is the InChIKey of 9-ethyl-3-nitrocarbazole?
The InChIKey is CBUNCFJCSLYKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H12N2O2/c2*1-2-15-13-6-4-3-5-11(13)12-9-10(16(17)18)7-8-14(12)15/h2*3-9H,2H2,1H3.
What are the key properties of 9-ethyl-3-nitrocarbazole?
9-ethyl-3-nitrocarbazole has a molecular weight of 480.52 g/mol, XLogP of 7.45, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-3-nitrocarbazole is sourced from PubChem (CID 139053303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).