About 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene
1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene (PubChem CID 139053399) has the molecular formula C16H14Br2Se
and a molecular weight of 445.06 g/mol. Its IUPAC name is 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene |
| PubChem CID | 139053399 |
| Molecular Formula | C16H14Br2Se |
| Molecular Weight | 445.06 g/mol |
| Exact Mass | 443.86 |
| IUPAC Name | 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene |
| SMILES | Cc1ccc([C@H]2[C@@H]([Se]c3ccccc3)C2(Br)Br)cc1 |
| InChI | InChI=1S/C16H14Br2Se/c1-11-7-9-12(10-8-11)14-15(16(14,17)18)19-13-5-3-2-4-6-13/h2-10,14-15H,1H3/t14-,15+/m0/s1 |
| InChIKey | ABBQLRYRGQCEQL-LSDHHAIUSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.06 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene?
The IUPAC name of 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene (CID 139053399) is 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene.
What is the SMILES notation for 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene?
The canonical SMILES for 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene is Cc1ccc([C@H]2[C@@H]([Se]c3ccccc3)C2(Br)Br)cc1.
What is the InChIKey of 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene?
The InChIKey is ABBQLRYRGQCEQL-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H14Br2Se/c1-11-7-9-12(10-8-11)14-15(16(14,17)18)19-13-5-3-2-4-6-13/h2-10,14-15H,1H3/t14-,15+/m0/s1.
What are the key properties of 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene?
1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene has a molecular weight of 445.06 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,3R)-2,2-dibromo-3-phenylselanylcyclopropyl]-4-methylbenzene is sourced from PubChem (CID 139053399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).