C20H18BrNO4 — CID 139053560
(1R,24R)-9-bromo-24-methyl-5,7,18,20-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-2,4(8),9,15,17(21),22-hexaene (PubChem CID 139053560) has the molecular formula C20H18BrNO4 and a molecular weight of 416.27 g/mol. Its IUPAC name is (1R,24R)-9-bromo-24-methyl-5,7,18,20-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-2,4(8),9,15,17(21),22-hexaene.
| Compound Name | (1R,24R)-9-bromo-24-methyl-5,7,18,20-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-2,4(8),9,15,17(21),22-hexaene |
|---|---|
| PubChem CID | 139053560 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | (1R,24R)-9-bromo-24-methyl-5,7,18,20-tetraoxa-13-azahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-2,4(8),9,15,17(21),22-hexaene |
| SMILES | C[C@@H]1c2cc3c(cc2CN2CCc4c(cc5c(c4Br)OCO5)[C@@H]12)OCO3 |
| InChI | InChI=1S/C20H18BrNO4/c1-10-13-5-16-15(23-8-24-16)4-11(13)7-22-3-2-12-14(19(10)22)6-17-20(18(12)21)26-9-25-17/h4-6,10,19H,2-3,7-9H2,1H3/t10-,19-/m1/s1 |
| InChIKey | XDQFTZSCVLPWMW-GIGQVBGESA-N |
| XLogP | 4.12 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |