C9H10ClNO — CID 139053635
(NE)-N-[(4-chloro-2,6-dimethylphenyl)methylidene]hydroxylamine (PubChem CID 139053635) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is (NE)-N-[(4-chloro-2,6-dimethylphenyl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4-chloro-2,6-dimethylphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 139053635 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (NE)-N-[(4-chloro-2,6-dimethylphenyl)methylidene]hydroxylamine |
| SMILES | Cc1cc(Cl)cc(C)c1/C=N/O |
| InChI | InChI=1S/C9H10ClNO/c1-6-3-8(10)4-7(2)9(6)5-11-12/h3-5,12H,1-2H3/b11-5+ |
| InChIKey | XQUHKUNQSOSDSS-VZUCSPMQSA-N |
| XLogP | 2.76 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|