C16H32O4 — CID 139053749
(E,3S,6R)-3,6-bis(methoxymethoxy)-2,2,7,7-tetramethyloct-4-ene (PubChem CID 139053749) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is (E,3S,6R)-3,6-bis(methoxymethoxy)-2,2,7,7-tetramethyloct-4-ene.
| Compound Name | (E,3S,6R)-3,6-bis(methoxymethoxy)-2,2,7,7-tetramethyloct-4-ene |
|---|---|
| PubChem CID | 139053749 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (E,3S,6R)-3,6-bis(methoxymethoxy)-2,2,7,7-tetramethyloct-4-ene |
| SMILES | COCO[C@@H](/C=C/[C@@H](OCOC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H32O4/c1-15(2,3)13(19-11-17-7)9-10-14(16(4,5)6)20-12-18-8/h9-10,13-14H,11-12H2,1-8H3/b10-9+/t13-,14+ |
| InChIKey | TXOFBQAYJZKIRT-BTUFVMOBSA-N |
| XLogP | 3.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|