C22H26O2Si — CID 139053750
(3S,3aS,7aR)-3-methyl-3-[methyl(diphenyl)silyl]-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 139053750) has the molecular formula C22H26O2Si and a molecular weight of 350.53 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-methyl-3-[methyl(diphenyl)silyl]-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | (3S,3aS,7aR)-3-methyl-3-[methyl(diphenyl)silyl]-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 139053750 |
| Molecular Formula | C22H26O2Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (3S,3aS,7aR)-3-methyl-3-[methyl(diphenyl)silyl]-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | C[C@@]1([Si](C)(c2ccccc2)c2ccccc2)C(=O)O[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H26O2Si/c1-22(19-15-9-10-16-20(19)24-21(22)23)25(2,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-8,11-14,19-20H,9-10,15-16H2,1-2H3/t19-,20+,22-/m0/s1 |
| InChIKey | MQAGHDUVQHFFIG-VWPQPMDRSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|