C21H32O6 — CID 139053850
[(1S,3R,3aS,5R,7aR)-3-acetyloxy-4-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-yl] acetate (PubChem CID 139053850) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(1S,3R,3aS,5R,7aR)-3-acetyloxy-4-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-yl] acetate.
| Compound Name | [(1S,3R,3aS,5R,7aR)-3-acetyloxy-4-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-yl] acetate |
|---|---|
| PubChem CID | 139053850 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(1S,3R,3aS,5R,7aR)-3-acetyloxy-4-oxo-5-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](OC(C)=O)[C@H]2C(=O)[C@@H]([C@@]3(C)CCCC(C)(C)C3)CC[C@@H]12 |
| InChI | InChI=1S/C21H32O6/c1-12(22)25-18-14-7-8-15(21(5)10-6-9-20(3,4)11-21)17(24)16(14)19(27-18)26-13(2)23/h14-16,18-19H,6-11H2,1-5H3/t14-,15+,16-,18-,19+,21+/m1/s1 |
| InChIKey | CBWUVYTVANWETC-ZRBNLFHZSA-N |
| XLogP | 3.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |