C10H16N2O2 — CID 139053875
(3S,9aS)-2,3-dimethyl-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 139053875) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3S,9aS)-2,3-dimethyl-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,9aS)-2,3-dimethyl-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 139053875 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (3S,9aS)-2,3-dimethyl-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | C[C@H]1C(=O)N2CCCC[C@H]2C(=O)N1C |
| InChI | InChI=1S/C10H16N2O2/c1-7-9(13)12-6-4-3-5-8(12)10(14)11(7)2/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | UHUSFUDZKMFTJX-YUMQZZPRSA-N |
| XLogP | 0.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |