C60H44N4O6 — CID 139053893
(18S)-1',3',3'-trimethylspiro[19-oxa-16-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),4,6,8,12,15(20),16,21-nonaene-18,2'-indole]-3,10-dione (PubChem CID 139053893) has the molecular formula C60H44N4O6 and a molecular weight of 917.03 g/mol. Its IUPAC name is (18S)-1',3',3'-trimethylspiro[19-oxa-16-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),4,6,8,12,15(20),16,21-nonaene-18,2'-indole]-3,10-dione.
| Compound Name | (18S)-1',3',3'-trimethylspiro[19-oxa-16-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),4,6,8,12,15(20),16,21-nonaene-18,2'-indole]-3,10-dione |
|---|---|
| PubChem CID | 139053893 |
| Molecular Formula | C60H44N4O6 |
| Molecular Weight | 917.03 g/mol |
| Exact Mass | 916.33 |
| IUPAC Name | (18S)-1',3',3'-trimethylspiro[19-oxa-16-azapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),4,6,8,12,15(20),16,21-nonaene-18,2'-indole]-3,10-dione |
| SMILES | CN1c2ccccc2C(C)(C)[C@]12C=Nc1c(ccc3c4c(ccc13)C(=O)c1ccccc1C4=O)O2.CN1c2ccccc2C(C)(C)[C@]12C=Nc1c(ccc3c4c(ccc13)C(=O)c1ccccc1C4=O)O2 |
| InChI | InChI=1S/2C30H22N2O3/c2*1-29(2)22-10-6-7-11-23(22)32(3)30(29)16-31-26-18-12-13-21-25(17(18)14-15-24(26)35-30)28(34)20-9-5-4-8-19(20)27(21)33/h2*4-16H,1-3H3/t2*30-/m11/s1 |
| InChIKey | VKYLMLRWFDHVSE-OQSVIDKASA-N |
| XLogP | 11.67 |
| TPSA | 117.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.03 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|