C48H38N2O4 — CID 139053965
(2S,3S,4'S)-3-methyl-3',4'-diphenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one (PubChem CID 139053965) has the molecular formula C48H38N2O4 and a molecular weight of 706.84 g/mol. Its IUPAC name is (2S,3S,4'S)-3-methyl-3',4'-diphenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one.
| Compound Name | (2S,3S,4'S)-3-methyl-3',4'-diphenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one |
|---|---|
| PubChem CID | 139053965 |
| Molecular Formula | C48H38N2O4 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | (2S,3S,4'S)-3-methyl-3',4'-diphenylspiro[3H-indene-2,5'-4H-1,2-oxazole]-1-one |
| SMILES | C[C@H]1c2ccccc2C(=O)[C@]12ON=C(c1ccccc1)[C@@H]2c1ccccc1.C[C@H]1c2ccccc2C(=O)[C@]12ON=C(c1ccccc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/2C24H19NO2/c2*1-16-19-14-8-9-15-20(19)23(26)24(16)21(17-10-4-2-5-11-17)22(25-27-24)18-12-6-3-7-13-18/h2*2-16,21H,1H3/t2*16-,21-,24-/m00/s1 |
| InChIKey | WACCYISSEHVAQD-SJBIWKGCSA-N |
| XLogP | 9.89 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |