About 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline
4-(4-hydroxyphenyl)phenol;1,10-phenanthroline (PubChem CID 139054123) has the molecular formula C24H18N2O2
and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline.
Molecular Properties
| Compound Name | 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline |
| PubChem CID | 139054123 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline |
| SMILES | Oc1ccc(-c2ccc(O)cc2)cc1.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C12H10O2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H;1-8,13-14H |
| InChIKey | LWPQPBZHQFRRMM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline?
The IUPAC name of 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline (CID 139054123) is 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline.
What is the SMILES notation for 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline?
The canonical SMILES for 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline is Oc1ccc(-c2ccc(O)cc2)cc1.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline?
The InChIKey is LWPQPBZHQFRRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C12H10O2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H;1-8,13-14H.
What are the key properties of 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline?
4-(4-hydroxyphenyl)phenol;1,10-phenanthroline has a molecular weight of 366.42 g/mol, XLogP of 5.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxyphenyl)phenol;1,10-phenanthroline is sourced from PubChem (CID 139054123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).