C41H48N2O3 — CID 139054299
methyl-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]azanium;N-methyl-N-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]carbamate;hydrate (PubChem CID 139054299) has the molecular formula C41H48N2O3 and a molecular weight of 616.85 g/mol. Its IUPAC name is methyl-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]azanium;N-methyl-N-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]carbamate;hydrate.
| Compound Name | methyl-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]azanium;N-methyl-N-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]carbamate;hydrate |
|---|---|
| PubChem CID | 139054299 |
| Molecular Formula | C41H48N2O3 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.37 |
| IUPAC Name | methyl-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]azanium;N-methyl-N-[3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propyl]carbamate;hydrate |
| SMILES | CN(CCCC12CCC(c3ccccc31)c1ccccc12)C(=O)[O-].C[NH2+]CCCC12CCC(c3ccccc31)c1ccccc12.O |
| InChI | InChI=1S/C21H23NO2.C20H23N.H2O/c1-22(20(23)24)14-6-12-21-13-11-15(16-7-2-4-9-18(16)21)17-8-3-5-10-19(17)21;1-21-14-6-12-20-13-11-15(16-7-2-4-9-18(16)20)17-8-3-5-10-19(17)20;/h2-5,7-10,15H,6,11-14H2,1H3,(H,23,24);2-5,7-10,15,21H,6,11-14H2,1H3;1H2 |
| InChIKey | ISOKPWVYXXQGDK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|