About bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine
bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine (PubChem CID 139054360) has the molecular formula C52H71NO4
and a molecular weight of 774.14 g/mol. Its IUPAC name is bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine.
Molecular Properties
| Compound Name | bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine |
| PubChem CID | 139054360 |
| Molecular Formula | C52H71NO4 |
| Molecular Weight | 774.14 g/mol |
| Exact Mass | 773.54 |
| IUPAC Name | bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine |
| SMILES | C[C@H](O)C(O)(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.C[C@H](O)C(O)(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.Cc1cccnc1 |
| InChI | InChI=1S/2C23H32O2.C6H7N/c2*1-16(24)23(25,19-12-8-17(9-13-19)21(2,3)4)20-14-10-18(11-15-20)22(5,6)7;1-6-3-2-4-7-5-6/h2*8-16,24-25H,1-7H3;2-5H,1H3/t2*16-;/m00./s1 |
| InChIKey | FVHXTUPDWODFAA-WUBQCMAVSA-N |
| XLogP | 11.19 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 774.14 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine?
The IUPAC name of bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine (CID 139054360) is bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine.
What is the SMILES notation for bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine?
The canonical SMILES for bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine is C[C@H](O)C(O)(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.C[C@H](O)C(O)(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.Cc1cccnc1.
What is the InChIKey of bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine?
The InChIKey is FVHXTUPDWODFAA-WUBQCMAVSA-N. The full InChI is InChI=1S/2C23H32O2.C6H7N/c2*1-16(24)23(25,19-12-8-17(9-13-19)21(2,3)4)20-14-10-18(11-15-20)22(5,6)7;1-6-3-2-4-7-5-6/h2*8-16,24-25H,1-7H3;2-5H,1H3/t2*16-;/m00./s1.
What are the key properties of bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine?
bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine has a molecular weight of 774.14 g/mol, XLogP of 11.19, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2S)-1,1-bis(4-tert-butylphenyl)propane-1,2-diol);3-methylpyridine is sourced from PubChem (CID 139054360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).