C15H20O10 — CID 139054519
trimethyl (1S,2S,3S,5R)-2-hydroxy-2-(2-methoxy-2-oxoethyl)-4-oxocyclohexane-1,3,5-tricarboxylate (PubChem CID 139054519) has the molecular formula C15H20O10 and a molecular weight of 360.32 g/mol. Its IUPAC name is trimethyl (1S,2S,3S,5R)-2-hydroxy-2-(2-methoxy-2-oxoethyl)-4-oxocyclohexane-1,3,5-tricarboxylate.
| Compound Name | trimethyl (1S,2S,3S,5R)-2-hydroxy-2-(2-methoxy-2-oxoethyl)-4-oxocyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 139054519 |
| Molecular Formula | C15H20O10 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | trimethyl (1S,2S,3S,5R)-2-hydroxy-2-(2-methoxy-2-oxoethyl)-4-oxocyclohexane-1,3,5-tricarboxylate |
| SMILES | COC(=O)C[C@@]1(O)[C@H](C(=O)OC)C(=O)[C@H](C(=O)OC)C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C15H20O10/c1-22-9(16)6-15(21)8(13(19)24-3)5-7(12(18)23-2)11(17)10(15)14(20)25-4/h7-8,10,21H,5-6H2,1-4H3/t7-,8-,10+,15+/m1/s1 |
| InChIKey | QLRPRHDEEQRYTR-HASSKOTFSA-N |
| XLogP | -1.38 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|