About (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one
(4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one (PubChem CID 139054551) has the molecular formula C10H10Br2O2
and a molecular weight of 322.00 g/mol. Its IUPAC name is (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one |
| PubChem CID | 139054551 |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one |
| SMILES | COC1=C/C(=C\[C@@H](C)Br)C=C(Br)C1=O |
| InChI | InChI=1S/C10H10Br2O2/c1-6(11)3-7-4-8(12)10(13)9(5-7)14-2/h3-6H,1-2H3/b7-3-/t6-/m1/s1 |
| InChIKey | XUVQSGOXWFJADJ-NPQKIFFKSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one?
The IUPAC name of (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one (CID 139054551) is (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one.
What is the SMILES notation for (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one?
The canonical SMILES for (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one is COC1=C/C(=C\[C@@H](C)Br)C=C(Br)C1=O.
What is the InChIKey of (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one?
The InChIKey is XUVQSGOXWFJADJ-NPQKIFFKSA-N. The full InChI is InChI=1S/C10H10Br2O2/c1-6(11)3-7-4-8(12)10(13)9(5-7)14-2/h3-6H,1-2H3/b7-3-/t6-/m1/s1.
What are the key properties of (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one?
(4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one has a molecular weight of 322.00 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-bromo-4-[(2R)-2-bromopropylidene]-6-methoxycyclohexa-2,5-dien-1-one is sourced from PubChem (CID 139054551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).