C22H21F3O9S — CID 139054727
[(2R,4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate (PubChem CID 139054727) has the molecular formula C22H21F3O9S and a molecular weight of 518.46 g/mol. Its IUPAC name is [(2R,4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate.
| Compound Name | [(2R,4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
|---|---|
| PubChem CID | 139054727 |
| Molecular Formula | C22H21F3O9S |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | [(2R,4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7-(trifluoromethylsulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OC(=O)c2ccccc2)[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H21F3O9S/c1-29-21-18(34-35(27,28)22(23,24)25)17(32-19(26)13-8-4-2-5-9-13)16-15(31-21)12-30-20(33-16)14-10-6-3-7-11-14/h2-11,15-18,20-21H,12H2,1H3/t15-,16-,17+,18+,20-,21+/m1/s1 |
| InChIKey | RZKSELVGZMHOQJ-CYGZGYCASA-N |
| XLogP | 2.93 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|