C15H20O4S — CID 139055044
(1S,2R,3S,5R)-1-(benzenesulfonyl)-2,5-dimethylbicyclo[3.2.0]heptane-2,3-diol (PubChem CID 139055044) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is (1S,2R,3S,5R)-1-(benzenesulfonyl)-2,5-dimethylbicyclo[3.2.0]heptane-2,3-diol.
| Compound Name | (1S,2R,3S,5R)-1-(benzenesulfonyl)-2,5-dimethylbicyclo[3.2.0]heptane-2,3-diol |
|---|---|
| PubChem CID | 139055044 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (1S,2R,3S,5R)-1-(benzenesulfonyl)-2,5-dimethylbicyclo[3.2.0]heptane-2,3-diol |
| SMILES | C[C@]12CC[C@@]1(S(=O)(=O)c1ccccc1)[C@](C)(O)[C@@H](O)C2 |
| InChI | InChI=1S/C15H20O4S/c1-13-8-9-15(13,14(2,17)12(16)10-13)20(18,19)11-6-4-3-5-7-11/h3-7,12,16-17H,8-10H2,1-2H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | WPFAWFVIRKYNIT-YJNKXOJESA-N |
| XLogP | 1.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |