About 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene
1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene (PubChem CID 139055092) has the molecular formula C50H32F12O2
and a molecular weight of 892.78 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene |
| PubChem CID | 139055092 |
| Molecular Formula | C50H32F12O2 |
| Molecular Weight | 892.78 g/mol |
| Exact Mass | 892.22 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene |
| SMILES | COc1ccc(-c2cccc3cccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c23)cc1.COc1ccc(-c2cccc3cccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c23)cc1 |
| InChI | InChI=1S/2C25H16F6O/c2*1-32-20-10-8-15(9-11-20)21-6-2-4-16-5-3-7-22(23(16)21)17-12-18(24(26,27)28)14-19(13-17)25(29,30)31/h2*2-14H,1H3 |
| InChIKey | FBFOGAOUUNZNSF-UHFFFAOYSA-N |
| XLogP | 16.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 892.78 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene (CID 139055092) is 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene is COc1ccc(-c2cccc3cccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c23)cc1.COc1ccc(-c2cccc3cccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c23)cc1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene?
The InChIKey is FBFOGAOUUNZNSF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C25H16F6O/c2*1-32-20-10-8-15(9-11-20)21-6-2-4-16-5-3-7-22(23(16)21)17-12-18(24(26,27)28)14-19(13-17)25(29,30)31/h2*2-14H,1H3.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene?
1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene has a molecular weight of 892.78 g/mol, XLogP of 16.44, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-8-(4-methoxyphenyl)naphthalene is sourced from PubChem (CID 139055092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).