C18H36B2O6 — CID 139055184
2-[2,3-dimethyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]butan-2-yl]oxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 139055184) has the molecular formula C18H36B2O6 and a molecular weight of 370.10 g/mol. Its IUPAC name is 2-[2,3-dimethyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]butan-2-yl]oxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2,3-dimethyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]butan-2-yl]oxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139055184 |
| Molecular Formula | C18H36B2O6 |
| Molecular Weight | 370.10 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 2-[2,3-dimethyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]butan-2-yl]oxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(OC(C)(C)C(C)(C)OB2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C18H36B2O6/c1-13(2)14(3,4)22-19(21-13)25-17(9,10)18(11,12)26-20-23-15(5,6)16(7,8)24-20/h1-12H3 |
| InChIKey | IRMMXCCNPHKSKC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.10 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|