C17H22N2O5 — CID 139055266
tert-butyl N-[(2R)-1-[[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 139055266) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 139055266 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(Z)-1-hydroxy-3-oxoprop-1-en-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)C(=O)N/C(C=O)=C\O |
| InChI | InChI=1S/C17H22N2O5/c1-17(2,3)24-16(23)19-14(9-12-7-5-4-6-8-12)15(22)18-13(10-20)11-21/h4-8,10-11,14,20H,9H2,1-3H3,(H,18,22)(H,19,23)/b13-10-/t14-/m1/s1 |
| InChIKey | XIHUOGKURVACQI-QLKUMGTLSA-N |
| XLogP | 1.84 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|