C21H30O5 — CID 139055447
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1S,5R,6R,7R)-2,2-dimethyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 139055447) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1S,5R,6R,7R)-2,2-dimethyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1S,5R,6R,7R)-2,2-dimethyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 139055447 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1S,5R,6R,7R)-2,2-dimethyl-4-oxo-3,10-dioxatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@@H]1[C@H]2C(=O)OC(C)(C)[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C21H30O5/c1-11(2)13-7-6-12(3)10-15(13)24-18(22)16-14-8-9-21(25-14)17(16)19(23)26-20(21,4)5/h8-9,11-17H,6-7,10H2,1-5H3/t12-,13+,14-,15-,16+,17+,21+/m1/s1 |
| InChIKey | AMHLRYLMZFMNGH-KZJVYPLVSA-N |
| XLogP | 3.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|