C30H24O4 — CID 139055633
(1S,2R,11S,12R)-tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione (PubChem CID 139055633) has the molecular formula C30H24O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is (1S,2R,11S,12R)-tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione.
| Compound Name | (1S,2R,11S,12R)-tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione |
|---|---|
| PubChem CID | 139055633 |
| Molecular Formula | C30H24O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (1S,2R,11S,12R)-tetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione |
| SMILES | O=C1c2ccccc2C(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1.O=C1c2ccccc2C(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/2C15H12O2/c2*16-14-10-3-1-2-4-11(10)15(17)13-9-6-5-8(7-9)12(13)14/h2*1-6,8-9,12-13H,7H2/t2*8-,9+,12-,13+ |
| InChIKey | NTOWIWWXTSSWKQ-RGPJRKIYSA-N |
| XLogP | 5.01 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|