About copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine
copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine (PubChem CID 139055665) has the molecular formula C15H15CuN3O3
and a molecular weight of 348.85 g/mol. Its IUPAC name is copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine.
Molecular Properties
| Compound Name | copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine |
| PubChem CID | 139055665 |
| Molecular Formula | C15H15CuN3O3 |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine |
| SMILES | CC(C)(/N=C/c1ccccc1[O-])C(=O)[O-].[Cu+2].c1cnccn1 |
| InChI | InChI=1S/C11H13NO3.C4H4N2.Cu/c1-11(2,10(14)15)12-7-8-5-3-4-6-9(8)13;1-2-6-4-3-5-1;/h3-7,13H,1-2H3,(H,14,15);1-4H;/q;;+2/p-2/b12-7+;; |
| InChIKey | GLJFGHBRTYDUQD-CURPJKDSSA-L |
| XLogP | 0.18 |
| TPSA | 101.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine?
The IUPAC name of copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine (CID 139055665) is copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine.
What is the SMILES notation for copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine?
The canonical SMILES for copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine is CC(C)(/N=C/c1ccccc1[O-])C(=O)[O-].[Cu+2].c1cnccn1.
What is the InChIKey of copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine?
The InChIKey is GLJFGHBRTYDUQD-CURPJKDSSA-L. The full InChI is InChI=1S/C11H13NO3.C4H4N2.Cu/c1-11(2,10(14)15)12-7-8-5-3-4-6-9(8)13;1-2-6-4-3-5-1;/h3-7,13H,1-2H3,(H,14,15);1-4H;/q;;+2/p-2/b12-7+;;.
What are the key properties of copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine?
copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine has a molecular weight of 348.85 g/mol, XLogP of 0.18, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-methyl-2-[(2-oxidophenyl)methylideneamino]propanoate;pyrazine is sourced from PubChem (CID 139055665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).