About [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate
[(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate (PubChem CID 139055913) has the molecular formula C17H20O6
and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate |
| PubChem CID | 139055913 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1C(C)=O)C[C@H](OC(C)=O)C(C)(C)O2 |
| InChI | InChI=1S/C17H20O6/c1-9(18)13-6-12-7-16(22-11(3)20)17(4,5)23-14(12)8-15(13)21-10(2)19/h6,8,16H,7H2,1-5H3/t16-/m0/s1 |
| InChIKey | FSAOKKRBOOKXNA-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate?
The IUPAC name of [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate (CID 139055913) is [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate.
What is the SMILES notation for [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate?
The canonical SMILES for [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate is CC(=O)Oc1cc2c(cc1C(C)=O)C[C@H](OC(C)=O)C(C)(C)O2.
What is the InChIKey of [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate?
The InChIKey is FSAOKKRBOOKXNA-INIZCTEOSA-N. The full InChI is InChI=1S/C17H20O6/c1-9(18)13-6-12-7-16(22-11(3)20)17(4,5)23-14(12)8-15(13)21-10(2)19/h6,8,16H,7H2,1-5H3/t16-/m0/s1.
What are the key properties of [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate?
[(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate has a molecular weight of 320.34 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-6-acetyl-7-acetyloxy-2,2-dimethyl-3,4-dihydrochromen-3-yl] acetate is sourced from PubChem (CID 139055913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).