C44H36N4O4 — CID 139056191
2,6-dimethyl-3,7-diphenyl-2,6-naphthyridine-1,5-dione (PubChem CID 139056191) has the molecular formula C44H36N4O4 and a molecular weight of 684.80 g/mol. Its IUPAC name is 2,6-dimethyl-3,7-diphenyl-2,6-naphthyridine-1,5-dione.
| Compound Name | 2,6-dimethyl-3,7-diphenyl-2,6-naphthyridine-1,5-dione |
|---|---|
| PubChem CID | 139056191 |
| Molecular Formula | C44H36N4O4 |
| Molecular Weight | 684.80 g/mol |
| Exact Mass | 684.27 |
| IUPAC Name | 2,6-dimethyl-3,7-diphenyl-2,6-naphthyridine-1,5-dione |
| SMILES | Cn1c(-c2ccccc2)cc2c(=O)n(C)c(-c3ccccc3)cc2c1=O.Cn1c(-c2ccccc2)cc2c(=O)n(C)c(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/2C22H18N2O2/c2*1-23-19(15-9-5-3-6-10-15)13-18-17(21(23)25)14-20(24(2)22(18)26)16-11-7-4-8-12-16/h2*3-14H,1-2H3 |
| InChIKey | JSUDSKBQMNQLIH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 88.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.80 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |